C30H39NO6S2 — CID 123200503
2-[1-ethyl-2,2,11,11-tetramethyl-4-(trioxidanylsulfanylmethyl)-9H-naphtho[3,2-g]quinolin-8-yl]-4-methylpent-2-ene-1-sulfonic acid (PubChem CID 123200503) has the molecular formula C30H39NO6S2 and a molecular weight of 573.78 g/mol. Its IUPAC name is 2-[1-ethyl-2,2,11,11-tetramethyl-4-(trioxidanylsulfanylmethyl)-9H-naphtho[3,2-g]quinolin-8-yl]-4-methylpent-2-ene-1-sulfonic acid.
| Compound Name | 2-[1-ethyl-2,2,11,11-tetramethyl-4-(trioxidanylsulfanylmethyl)-9H-naphtho[3,2-g]quinolin-8-yl]-4-methylpent-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 123200503 |
| Molecular Formula | C30H39NO6S2 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 2-[1-ethyl-2,2,11,11-tetramethyl-4-(trioxidanylsulfanylmethyl)-9H-naphtho[3,2-g]quinolin-8-yl]-4-methylpent-2-ene-1-sulfonic acid |
| SMILES | CCN1c2cc3c(cc2C(CSOOO)=CC1(C)C)C=C1C=C(C(=CC(C)C)CS(=O)(=O)O)CC=C1C3(C)C |
| InChI | InChI=1S/C30H39NO6S2/c1-8-31-28-15-27-22(14-25(28)24(16-29(31,4)5)17-38-37-36-32)13-21-12-20(9-10-26(21)30(27,6)7)23(11-19(2)3)18-39(33,34)35/h10-16,19,32H,8-9,17-18H2,1-7H3,(H,33,34,35) |
| InChIKey | WSIPTGMFROGJCN-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|