C32H41N2O5S+ — CID 58689938
2-[20-ethyl-2,2,7,7,9,19,19-heptamethyl-17-(trioxidanylsulfanylmethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,13,15,17,20-octaen-6-yl]acetic acid (PubChem CID 58689938) has the molecular formula C32H41N2O5S+ and a molecular weight of 565.76 g/mol. Its IUPAC name is 2-[20-ethyl-2,2,7,7,9,19,19-heptamethyl-17-(trioxidanylsulfanylmethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,13,15,17,20-octaen-6-yl]acetic acid.
| Compound Name | 2-[20-ethyl-2,2,7,7,9,19,19-heptamethyl-17-(trioxidanylsulfanylmethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,13,15,17,20-octaen-6-yl]acetic acid |
|---|---|
| PubChem CID | 58689938 |
| Molecular Formula | C32H41N2O5S+ |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 2-[20-ethyl-2,2,7,7,9,19,19-heptamethyl-17-(trioxidanylsulfanylmethyl)-6-aza-20-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),11,13,15,17,20-octaen-6-yl]acetic acid |
| SMILES | CC[N+]1=c2cc3c(cc2C(CSOOO)=CC1(C)C)=Cc1cc2c(cc1C3(C)C)N(CC(=O)O)C(C)(C)CC2C |
| InChI | InChI=1S/C32H40N2O5S/c1-9-33-28-14-26-21(12-24(28)22(16-31(33,5)6)18-40-39-38-37)10-20-11-23-19(2)15-30(3,4)34(17-29(35)36)27(23)13-25(20)32(26,7)8/h10-14,16,19H,9,15,17-18H2,1-8H3,(H-,35,36,37)/p+1 |
| InChIKey | MHHQJEZFNOIDSG-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|