C31H43N4O5S+ — CID 58350934
1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N,N-bis(2-hydroxyethyl)methanesulfonamide (PubChem CID 58350934) has the molecular formula C31H43N4O5S+ and a molecular weight of 583.78 g/mol. Its IUPAC name is 1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N,N-bis(2-hydroxyethyl)methanesulfonamide.
| Compound Name | 1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N,N-bis(2-hydroxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 58350934 |
| Molecular Formula | C31H43N4O5S+ |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)-N,N-bis(2-hydroxyethyl)methanesulfonamide |
| SMILES | CC[N+]1=c2cc3c(cc2C(CS(=O)(=O)N(CCO)CCO)=CC1(C)C)=Nc1cc2c(cc1O3)N(C)C(C)(C)CC2C |
| InChI | InChI=1S/C31H43N4O5S/c1-8-35-27-16-29-25(32-24-13-22-20(2)17-30(3,4)33(7)26(22)15-28(24)40-29)14-23(27)21(18-31(35,5)6)19-41(38,39)34(9-11-36)10-12-37/h13-16,18,20,36-37H,8-12,17,19H2,1-7H3/q+1 |
| InChIKey | JCUKJICWLCHKHG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|