C30H40N2O4S — CID 90047883
4-[8-[(Z)-4,4-dimethylpent-2-en-2-yl]-2,2,4-trimethyl-9-methylidene-3,4-dihydropyrido[3,2-b]phenoxazin-1-yl]butane-1-sulfonic acid (PubChem CID 90047883) has the molecular formula C30H40N2O4S and a molecular weight of 524.73 g/mol. Its IUPAC name is 4-[8-[(Z)-4,4-dimethylpent-2-en-2-yl]-2,2,4-trimethyl-9-methylidene-3,4-dihydropyrido[3,2-b]phenoxazin-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[8-[(Z)-4,4-dimethylpent-2-en-2-yl]-2,2,4-trimethyl-9-methylidene-3,4-dihydropyrido[3,2-b]phenoxazin-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 90047883 |
| Molecular Formula | C30H40N2O4S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 4-[8-[(Z)-4,4-dimethylpent-2-en-2-yl]-2,2,4-trimethyl-9-methylidene-3,4-dihydropyrido[3,2-b]phenoxazin-1-yl]butane-1-sulfonic acid |
| SMILES | C=c1cc2c(cc1/C(C)=C\C(C)(C)C)=Nc1cc3c(cc1O2)N(CCCCS(=O)(=O)O)C(C)(C)CC3C |
| InChI | InChI=1S/C30H40N2O4S/c1-19-13-27-24(14-22(19)20(2)17-29(4,5)6)31-25-15-23-21(3)18-30(7,8)32(26(23)16-28(25)36-27)11-9-10-12-37(33,34)35/h13-17,21H,1,9-12,18H2,2-8H3,(H,33,34,35)/b20-17- |
| InChIKey | UKRBGLZTLVMJIB-JZJYNLBNSA-N |
| XLogP | 6.36 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|