C20H29NO4 — CID 57307043
[1-acetyloxy-3-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)propyl] acetate (PubChem CID 57307043) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [1-acetyloxy-3-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)propyl] acetate.
| Compound Name | [1-acetyloxy-3-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)propyl] acetate |
|---|---|
| PubChem CID | 57307043 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [1-acetyloxy-3-(2,2,4,7-tetramethyl-3,4-dihydroquinolin-1-yl)propyl] acetate |
| SMILES | CC(=O)OC(CCN1c2cc(C)ccc2C(C)CC1(C)C)OC(C)=O |
| InChI | InChI=1S/C20H29NO4/c1-13-7-8-17-14(2)12-20(5,6)21(18(17)11-13)10-9-19(24-15(3)22)25-16(4)23/h7-8,11,14,19H,9-10,12H2,1-6H3 |
| InChIKey | QAQRQEQZQNRVGN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|