C15H22NNaO3S2 — CID 70570146
sodium 2,2,4,7-tetramethyl-1-(2-sulfonatosulfanylethyl)-3,4-dihydroquinoline (PubChem CID 70570146) has the molecular formula C15H22NNaO3S2 and a molecular weight of 351.47 g/mol. Its IUPAC name is sodium 2,2,4,7-tetramethyl-1-(2-sulfonatosulfanylethyl)-3,4-dihydroquinoline.
| Compound Name | sodium 2,2,4,7-tetramethyl-1-(2-sulfonatosulfanylethyl)-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 70570146 |
| Molecular Formula | C15H22NNaO3S2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | sodium 2,2,4,7-tetramethyl-1-(2-sulfonatosulfanylethyl)-3,4-dihydroquinoline |
| SMILES | Cc1ccc2c(c1)N(CCSS(=O)(=O)[O-])C(C)(C)CC2C.[Na+] |
| InChI | InChI=1S/C15H23NO3S2.Na/c1-11-5-6-13-12(2)10-15(3,4)16(14(13)9-11)7-8-20-21(17,18)19;/h5-6,9,12H,7-8,10H2,1-4H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | YIVAZUAHELYEIP-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|