C19H29NO5S — CID 142983714
[1-(4-ethoxy-4-oxobutyl)-2,2,7-trimethyl-3,4-dihydroquinolin-4-yl]methanesulfonic acid (PubChem CID 142983714) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is [1-(4-ethoxy-4-oxobutyl)-2,2,7-trimethyl-3,4-dihydroquinolin-4-yl]methanesulfonic acid.
| Compound Name | [1-(4-ethoxy-4-oxobutyl)-2,2,7-trimethyl-3,4-dihydroquinolin-4-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 142983714 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [1-(4-ethoxy-4-oxobutyl)-2,2,7-trimethyl-3,4-dihydroquinolin-4-yl]methanesulfonic acid |
| SMILES | CCOC(=O)CCCN1c2cc(C)ccc2C(CS(=O)(=O)O)CC1(C)C |
| InChI | InChI=1S/C19H29NO5S/c1-5-25-18(21)7-6-10-20-17-11-14(2)8-9-16(17)15(12-19(20,3)4)13-26(22,23)24/h8-9,11,15H,5-7,10,12-13H2,1-4H3,(H,22,23,24) |
| InChIKey | QFCFBEAYLHBEHW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|