C22H36NO5P — CID 118457223
butyl 4-[4-(dimethoxyphosphanylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinolin-1-yl]butanoate (PubChem CID 118457223) has the molecular formula C22H36NO5P and a molecular weight of 425.51 g/mol. Its IUPAC name is butyl 4-[4-(dimethoxyphosphanylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinolin-1-yl]butanoate.
| Compound Name | butyl 4-[4-(dimethoxyphosphanylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinolin-1-yl]butanoate |
|---|---|
| PubChem CID | 118457223 |
| Molecular Formula | C22H36NO5P |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | butyl 4-[4-(dimethoxyphosphanylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinolin-1-yl]butanoate |
| SMILES | CCCCOC(=O)CCCN1c2cc(O)ccc2C(CP(OC)OC)CC1(C)C |
| InChI | InChI=1S/C22H36NO5P/c1-6-7-13-28-21(25)9-8-12-23-20-14-18(24)10-11-19(20)17(15-22(23,2)3)16-29(26-4)27-5/h10-11,14,17,24H,6-9,12-13,15-16H2,1-5H3 |
| InChIKey | ZXYPQWWBAJNLGN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|