C32H34ClNO5 — CID 129147759
ethyl 4-(8'-chloro-9'-hydroxy-2',2',4'-trimethylspiro[1H-2-benzofuran-3,6'-3,4-dihydrochromeno[3,2-g]quinoline]-1'-yl)butanoate (PubChem CID 129147759) has the molecular formula C32H34ClNO5 and a molecular weight of 548.08 g/mol. Its IUPAC name is ethyl 4-(8'-chloro-9'-hydroxy-2',2',4'-trimethylspiro[1H-2-benzofuran-3,6'-3,4-dihydrochromeno[3,2-g]quinoline]-1'-yl)butanoate.
| Compound Name | ethyl 4-(8'-chloro-9'-hydroxy-2',2',4'-trimethylspiro[1H-2-benzofuran-3,6'-3,4-dihydrochromeno[3,2-g]quinoline]-1'-yl)butanoate |
|---|---|
| PubChem CID | 129147759 |
| Molecular Formula | C32H34ClNO5 |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | ethyl 4-(8'-chloro-9'-hydroxy-2',2',4'-trimethylspiro[1H-2-benzofuran-3,6'-3,4-dihydrochromeno[3,2-g]quinoline]-1'-yl)butanoate |
| SMILES | CCOC(=O)CCCN1c2cc3c(cc2C(C)CC1(C)C)C1(OCc2ccccc21)c1cc(Cl)c(O)cc1O3 |
| InChI | InChI=1S/C32H34ClNO5/c1-5-37-30(36)11-8-12-34-26-15-28-23(13-21(26)19(2)17-31(34,3)4)32(22-10-7-6-9-20(22)18-38-32)24-14-25(33)27(35)16-29(24)39-28/h6-7,9-10,13-16,19,35H,5,8,11-12,17-18H2,1-4H3 |
| InChIKey | VPFUGIYAHFADJY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |