C21H34N2O — CID 59079307
2,2,4,7-tetramethyl-6-nitroso-1-octyl-3,4-dihydroquinoline (PubChem CID 59079307) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 2,2,4,7-tetramethyl-6-nitroso-1-octyl-3,4-dihydroquinoline.
| Compound Name | 2,2,4,7-tetramethyl-6-nitroso-1-octyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 59079307 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 2,2,4,7-tetramethyl-6-nitroso-1-octyl-3,4-dihydroquinoline |
| SMILES | CCCCCCCCN1c2cc(C)c(N=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C21H34N2O/c1-6-7-8-9-10-11-12-23-20-13-16(2)19(22-24)14-18(20)17(3)15-21(23,4)5/h13-14,17H,6-12,15H2,1-5H3 |
| InChIKey | CNQCOGPEPWTXOI-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|