C26H26N2O5 — CID 135150440
4-[3-(1,3-benzoxazol-2-yl)-6,8,8-trimethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid (PubChem CID 135150440) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 4-[3-(1,3-benzoxazol-2-yl)-6,8,8-trimethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid.
| Compound Name | 4-[3-(1,3-benzoxazol-2-yl)-6,8,8-trimethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 135150440 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-[3-(1,3-benzoxazol-2-yl)-6,8,8-trimethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid |
| SMILES | CC1CC(C)(C)N(CCCC(=O)O)c2cc3oc(=O)c(-c4nc5ccccc5o4)cc3cc21 |
| InChI | InChI=1S/C26H26N2O5/c1-15-14-26(2,3)28(10-6-9-23(29)30)20-13-22-16(11-17(15)20)12-18(25(31)33-22)24-27-19-7-4-5-8-21(19)32-24/h4-5,7-8,11-13,15H,6,9-10,14H2,1-3H3,(H,29,30) |
| InChIKey | DIDXQCXTUXQEIW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|