C25H29N2O4+ — CID 164531704
4-[6,8,8-trimethyl-3-(2-methylpyridin-1-ium-4-yl)-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid (PubChem CID 164531704) has the molecular formula C25H29N2O4+ and a molecular weight of 421.52 g/mol. Its IUPAC name is 4-[6,8,8-trimethyl-3-(2-methylpyridin-1-ium-4-yl)-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid.
| Compound Name | 4-[6,8,8-trimethyl-3-(2-methylpyridin-1-ium-4-yl)-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 164531704 |
| Molecular Formula | C25H29N2O4+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 4-[6,8,8-trimethyl-3-(2-methylpyridin-1-ium-4-yl)-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl]butanoic acid |
| SMILES | Cc1cc(-c2cc3cc4c(cc3oc2=O)N(CCCC(=O)O)C(C)(C)CC4C)cc[nH+]1 |
| InChI | InChI=1S/C25H28N2O4/c1-15-14-25(3,4)27(9-5-6-23(28)29)21-13-22-18(11-19(15)21)12-20(24(30)31-22)17-7-8-26-16(2)10-17/h7-8,10-13,15H,5-6,9,14H2,1-4H3,(H,28,29)/p+1 |
| InChIKey | LQONWRFLLHNVNK-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|