C27H33N2O6S+ — CID 164974995
4-[6-methyl-3-[2-methyl-1-(3-methylsulfonylpropyl)pyridin-1-ium-4-yl]-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-9-yl]butanoic acid (PubChem CID 164974995) has the molecular formula C27H33N2O6S+ and a molecular weight of 513.64 g/mol. Its IUPAC name is 4-[6-methyl-3-[2-methyl-1-(3-methylsulfonylpropyl)pyridin-1-ium-4-yl]-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-9-yl]butanoic acid.
| Compound Name | 4-[6-methyl-3-[2-methyl-1-(3-methylsulfonylpropyl)pyridin-1-ium-4-yl]-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 164974995 |
| Molecular Formula | C27H33N2O6S+ |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 4-[6-methyl-3-[2-methyl-1-(3-methylsulfonylpropyl)pyridin-1-ium-4-yl]-2-oxo-7,8-dihydro-6H-pyrano[3,2-g]quinolin-9-yl]butanoic acid |
| SMILES | Cc1cc(-c2cc3cc4c(cc3oc2=O)N(CCCC(=O)O)CCC4C)cc[n+]1CCCS(C)(=O)=O |
| InChI | InChI=1S/C27H32N2O6S/c1-18-7-11-29(9-4-6-26(30)31)24-17-25-21(15-22(18)24)16-23(27(32)35-25)20-8-12-28(19(2)14-20)10-5-13-36(3,33)34/h8,12,14-18H,4-7,9-11,13H2,1-3H3/p+1 |
| InChIKey | BXTQWVQXKZFDIE-UHFFFAOYSA-O |
| XLogP | 3.67 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|