C21H19F5N2O6S — CID 144894722
4-[8,10-difluoro-4-methyl-9-(trifluoromethylsulfonyloxy)-2,3,4,6-tetrahydropyrido[3,2-b]phenoxazin-1-yl]butanoic acid (PubChem CID 144894722) has the molecular formula C21H19F5N2O6S and a molecular weight of 522.45 g/mol. Its IUPAC name is 4-[8,10-difluoro-4-methyl-9-(trifluoromethylsulfonyloxy)-2,3,4,6-tetrahydropyrido[3,2-b]phenoxazin-1-yl]butanoic acid.
| Compound Name | 4-[8,10-difluoro-4-methyl-9-(trifluoromethylsulfonyloxy)-2,3,4,6-tetrahydropyrido[3,2-b]phenoxazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 144894722 |
| Molecular Formula | C21H19F5N2O6S |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 4-[8,10-difluoro-4-methyl-9-(trifluoromethylsulfonyloxy)-2,3,4,6-tetrahydropyrido[3,2-b]phenoxazin-1-yl]butanoic acid |
| SMILES | CC1CCN(CCCC(=O)O)c2cc3c(cc21)Nc1cc(F)c(OS(=O)(=O)C(F)(F)F)c(F)c1O3 |
| InChI | InChI=1S/C21H19F5N2O6S/c1-10-4-6-28(5-2-3-17(29)30)15-9-16-13(7-11(10)15)27-14-8-12(22)19(18(23)20(14)33-16)34-35(31,32)21(24,25)26/h7-10,27H,2-6H2,1H3,(H,29,30) |
| InChIKey | MJFJUCOVTABSLD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|