C23H24N3O3+ — CID 169208634
4-(7-methyl-13-oxa-3,17-diaza-7-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2(11),3,5,7,9,15,21-octaen-17-yl)butanoic acid (PubChem CID 169208634) has the molecular formula C23H24N3O3+ and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-(7-methyl-13-oxa-3,17-diaza-7-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2(11),3,5,7,9,15,21-octaen-17-yl)butanoic acid.
| Compound Name | 4-(7-methyl-13-oxa-3,17-diaza-7-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2(11),3,5,7,9,15,21-octaen-17-yl)butanoic acid |
|---|---|
| PubChem CID | 169208634 |
| Molecular Formula | C23H24N3O3+ |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-(7-methyl-13-oxa-3,17-diaza-7-azoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(14),2(11),3,5,7,9,15,21-octaen-17-yl)butanoic acid |
| SMILES | C[n+]1ccc2nc3c(cc2c1)COc1cc2c(cc1-3)CCCN2CCCC(=O)O |
| InChI | InChI=1S/C23H23N3O3/c1-25-9-6-19-16(13-25)10-17-14-29-21-12-20-15(11-18(21)23(17)24-19)4-2-7-26(20)8-3-5-22(27)28/h6,9-13H,2-5,7-8,14H2,1H3/p+1 |
| InChIKey | KVLRJRBWEPTJQI-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|