5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid

C17H23NO3 — CID 82263541

IUPAC5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid
SMILESCCCN1CCCc2ccc(C(=O)CCCC(=O)O)cc21
InChIInChI=1S/C17H23NO3/c1-2-10-18-11-4-5-13-8-9-14(12-15(13)18)16(19)6-3-7-17(20)21/h8-9,12H,2-7,10-11H2,1H3,(H,20,21)
InChIKeyREPVRVPPHBKLBA-UHFFFAOYSA-N
MW289.38 g/mol
LogP3.29
Rot. Bonds7

About 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid

5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid (PubChem CID 82263541) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid.

Molecular Properties

Compound Name5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid
PubChem CID82263541
Molecular FormulaC17H23NO3
Molecular Weight289.38 g/mol
Exact Mass289.17
IUPAC Name5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid
SMILESCCCN1CCCc2ccc(C(=O)CCCC(=O)O)cc21
InChIInChI=1S/C17H23NO3/c1-2-10-18-11-4-5-13-8-9-14(12-15(13)18)16(19)6-3-7-17(20)21/h8-9,12H,2-7,10-11H2,1H3,(H,20,21)
InChIKeyREPVRVPPHBKLBA-UHFFFAOYSA-N
XLogP3.29
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.38
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid?
The IUPAC name of 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid (CID 82263541) is 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid.
What is the SMILES notation for 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid?
The canonical SMILES for 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid is CCCN1CCCc2ccc(C(=O)CCCC(=O)O)cc21.
What is the InChIKey of 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid?
The InChIKey is REPVRVPPHBKLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-2-10-18-11-4-5-13-8-9-14(12-15(13)18)16(19)6-3-7-17(20)21/h8-9,12H,2-7,10-11H2,1H3,(H,20,21).
What are the key properties of 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid?
5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid has a molecular weight of 289.38 g/mol, XLogP of 3.29, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid is sourced from PubChem (CID 82263541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).