C17H23NO3 — CID 82263541
5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid (PubChem CID 82263541) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid.
| Compound Name | 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid |
|---|---|
| PubChem CID | 82263541 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 5-oxo-5-(1-propyl-3,4-dihydro-2H-quinolin-7-yl)pentanoic acid |
| SMILES | CCCN1CCCc2ccc(C(=O)CCCC(=O)O)cc21 |
| InChI | InChI=1S/C17H23NO3/c1-2-10-18-11-4-5-13-8-9-14(12-15(13)18)16(19)6-3-7-17(20)21/h8-9,12H,2-7,10-11H2,1H3,(H,20,21) |
| InChIKey | REPVRVPPHBKLBA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |