C32H34N2O4 — CID 122650863
5-[4-(20-ethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)phenoxy]pentanoic acid (PubChem CID 122650863) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is 5-[4-(20-ethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)phenoxy]pentanoic acid.
| Compound Name | 5-[4-(20-ethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 122650863 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 5-[4-(20-ethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)phenoxy]pentanoic acid |
| SMILES | CCN1CCCc2cc3c(cc21)Oc1cc2c(cc1=C3c1ccc(OCCCCC(=O)O)cc1)CCCN=2 |
| InChI | InChI=1S/C32H34N2O4/c1-2-34-15-6-8-23-18-26-30(20-28(23)34)38-29-19-27-22(7-5-14-33-27)17-25(29)32(26)21-10-12-24(13-11-21)37-16-4-3-9-31(35)36/h10-13,17-20H,2-9,14-16H2,1H3,(H,35,36) |
| InChIKey | OYAAJXQFSKBNQT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|