C31H33N3O3 — CID 122605925
2-(20,22-dimethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)-N-(2-hydroxyethyl)-N-methylbenzamide (PubChem CID 122605925) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-(20,22-dimethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)-N-(2-hydroxyethyl)-N-methylbenzamide.
| Compound Name | 2-(20,22-dimethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)-N-(2-hydroxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 122605925 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-(20,22-dimethyl-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)-N-(2-hydroxyethyl)-N-methylbenzamide |
| SMILES | Cc1c2c(cc3c1N(C)CCC3)C(c1ccccc1C(=O)N(C)CCO)=c1cc3c(cc1O2)=NCCC3 |
| InChI | InChI=1S/C31H33N3O3/c1-19-29-21(9-7-13-33(29)2)17-25-28(22-10-4-5-11-23(22)31(36)34(3)14-15-35)24-16-20-8-6-12-32-26(20)18-27(24)37-30(19)25/h4-5,10-11,16-18,35H,6-9,12-15H2,1-3H3 |
| InChIKey | SVARFYIIBSKGRH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|