C29H28N2O2 — CID 126581154
2-(2,2-dimethyl-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid (PubChem CID 126581154) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-(2,2-dimethyl-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid.
| Compound Name | 2-(2,2-dimethyl-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid |
|---|---|
| PubChem CID | 126581154 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-(2,2-dimethyl-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzoic acid |
| SMILES | CC1(C)c2cc3c(cc2C(c2ccccc2C(=O)O)=c2cc4c(cc21)=NCCC4)CCCN3 |
| InChI | InChI=1S/C29H28N2O2/c1-29(2)23-15-25-17(7-5-11-30-25)13-21(23)27(19-9-3-4-10-20(19)28(32)33)22-14-18-8-6-12-31-26(18)16-24(22)29/h3-4,9-10,13-16,30H,5-8,11-12H2,1-2H3,(H,32,33) |
| InChIKey | PMVCZEPUHPZNMJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |