C23H27N3O2Si — CID 164933499
4-(2-methyl-6,13,20-triaza-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-2-yl)butanoic acid (PubChem CID 164933499) has the molecular formula C23H27N3O2Si and a molecular weight of 405.57 g/mol. Its IUPAC name is 4-(2-methyl-6,13,20-triaza-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-2-yl)butanoic acid.
| Compound Name | 4-(2-methyl-6,13,20-triaza-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 164933499 |
| Molecular Formula | C23H27N3O2Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-(2-methyl-6,13,20-triaza-2-silapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-2-yl)butanoic acid |
| SMILES | C[Si]1(CCCC(=O)O)c2cc3c(cc2N=c2cc4c(cc21)=NCCC4)CCCN3 |
| InChI | InChI=1S/C23H27N3O2Si/c1-29(10-4-7-23(27)28)21-13-17-15(5-2-8-24-17)11-19(21)26-20-12-16-6-3-9-25-18(16)14-22(20)29/h11-14,24H,2-10H2,1H3,(H,27,28) |
| InChIKey | JXOAGGQLZADCQX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|