C24H30N3O+ — CID 169044181
6-(4-methylpentyl)-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene (PubChem CID 169044181) has the molecular formula C24H30N3O+ and a molecular weight of 376.52 g/mol. Its IUPAC name is 6-(4-methylpentyl)-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene.
| Compound Name | 6-(4-methylpentyl)-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene |
|---|---|
| PubChem CID | 169044181 |
| Molecular Formula | C24H30N3O+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 6-(4-methylpentyl)-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaene |
| SMILES | CC(C)CCC[N+]1=c2cc3c(cc2CCC1)=Nc1cc2c(cc1O3)NCCC2 |
| InChI | InChI=1S/C24H29N3O/c1-16(2)6-4-10-27-11-5-8-18-13-21-24(15-22(18)27)28-23-14-19-17(7-3-9-25-19)12-20(23)26-21/h12-16H,3-11H2,1-2H3/p+1 |
| InChIKey | SKJPERNUCRANIC-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 36.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|