C29H29N3O3 — CID 44542873
N-(2-hydroxyethyl)-N-methyl-2-(2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzamide (PubChem CID 44542873) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-methyl-2-(2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzamide.
| Compound Name | N-(2-hydroxyethyl)-N-methyl-2-(2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzamide |
|---|---|
| PubChem CID | 44542873 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-(2-hydroxyethyl)-N-methyl-2-(2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,10,12,15,21-heptaen-13-yl)benzamide |
| SMILES | CN(CCO)C(=O)c1ccccc1C1=c2cc3c(cc2Oc2cc4c(cc21)CCCN4)=NCCC3 |
| InChI | InChI=1S/C29H29N3O3/c1-32(12-13-33)29(34)21-9-3-2-8-20(21)28-22-14-18-6-4-10-30-24(18)16-26(22)35-27-17-25-19(15-23(27)28)7-5-11-31-25/h2-3,8-9,14-17,30,33H,4-7,10-13H2,1H3 |
| InChIKey | AVDXVISVIGTISJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |