C27H24N4O4 — CID 126615501
(3'-oxospiro[2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),4,10,15,21-hexaene-13,1'-isoindole]-2'-yl)carbamic acid (PubChem CID 126615501) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is (3'-oxospiro[2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),4,10,15,21-hexaene-13,1'-isoindole]-2'-yl)carbamic acid.
| Compound Name | (3'-oxospiro[2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),4,10,15,21-hexaene-13,1'-isoindole]-2'-yl)carbamic acid |
|---|---|
| PubChem CID | 126615501 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (3'-oxospiro[2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),4,10,15,21-hexaene-13,1'-isoindole]-2'-yl)carbamic acid |
| SMILES | O=C(O)NN1C(=O)c2ccccc2C12c1cc3c(cc1Oc1cc4c(cc12)CCCN4)NCCC3 |
| InChI | InChI=1S/C27H24N4O4/c32-25-17-7-1-2-8-18(17)27(31(25)30-26(33)34)19-11-15-5-3-9-28-21(15)13-23(19)35-24-14-22-16(12-20(24)27)6-4-10-29-22/h1-2,7-8,11-14,28-30H,3-6,9-10H2,(H,33,34) |
| InChIKey | HQNIXVKOOFCADL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|