C30H38N2O6S — CID 135226142
3-[3-[1-(6-methoxyhexyl)pyridin-1-ium-4-yl]-6,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-9-yl]propane-1-sulfonate (PubChem CID 135226142) has the molecular formula C30H38N2O6S and a molecular weight of 554.71 g/mol. Its IUPAC name is 3-[3-[1-(6-methoxyhexyl)pyridin-1-ium-4-yl]-6,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-9-yl]propane-1-sulfonate.
| Compound Name | 3-[3-[1-(6-methoxyhexyl)pyridin-1-ium-4-yl]-6,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-9-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 135226142 |
| Molecular Formula | C30H38N2O6S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 3-[3-[1-(6-methoxyhexyl)pyridin-1-ium-4-yl]-6,8,8-trimethyl-2-oxopyrano[3,2-g]quinolin-9-yl]propane-1-sulfonate |
| SMILES | COCCCCCC[n+]1ccc(-c2cc3cc4c(cc3oc2=O)N(CCCS(=O)(=O)[O-])C(C)(C)C=C4C)cc1 |
| InChI | InChI=1S/C30H38N2O6S/c1-22-21-30(2,3)32(13-9-17-39(34,35)36)27-20-28-24(18-25(22)27)19-26(29(33)38-28)23-10-14-31(15-11-23)12-7-5-6-8-16-37-4/h10-11,14-15,18-21H,5-9,12-13,16-17H2,1-4H3 |
| InChIKey | KFLSOAQCEROLHP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 103.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|