C29H37N2O7S+ — CID 46218985
6-[4-[6,8,8-trimethyl-2-oxo-9-(3-sulfopropyl)-3,4-dihydropyrano[3,2-g]quinolin-3-yl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 46218985) has the molecular formula C29H37N2O7S+ and a molecular weight of 557.69 g/mol. Its IUPAC name is 6-[4-[6,8,8-trimethyl-2-oxo-9-(3-sulfopropyl)-3,4-dihydropyrano[3,2-g]quinolin-3-yl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[4-[6,8,8-trimethyl-2-oxo-9-(3-sulfopropyl)-3,4-dihydropyrano[3,2-g]quinolin-3-yl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 46218985 |
| Molecular Formula | C29H37N2O7S+ |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 6-[4-[6,8,8-trimethyl-2-oxo-9-(3-sulfopropyl)-3,4-dihydropyrano[3,2-g]quinolin-3-yl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | CC1=CC(C)(C)N(CCCS(=O)(=O)O)c2cc3c(cc21)CC(c1cc[n+](CCCCCC(=O)O)cc1)C(=O)O3 |
| InChI | InChI=1S/C29H36N2O7S/c1-20-19-29(2,3)31(12-7-15-39(35,36)37)25-18-26-22(16-23(20)25)17-24(28(34)38-26)21-9-13-30(14-10-21)11-6-4-5-8-27(32)33/h9-10,13-14,16,18-19,24H,4-8,11-12,15,17H2,1-3H3,(H-,32,33,35,36,37)/p+1 |
| InChIKey | DXRQXBRBBWYTRZ-UHFFFAOYSA-O |
| XLogP | 4.14 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|