C22H24F3NO4 — CID 160845239
6-[6,8,8-trimethyl-2-oxo-4-(trifluoromethyl)pyrano[3,2-g]quinolin-9-yl]hexanoic acid (PubChem CID 160845239) has the molecular formula C22H24F3NO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 6-[6,8,8-trimethyl-2-oxo-4-(trifluoromethyl)pyrano[3,2-g]quinolin-9-yl]hexanoic acid.
| Compound Name | 6-[6,8,8-trimethyl-2-oxo-4-(trifluoromethyl)pyrano[3,2-g]quinolin-9-yl]hexanoic acid |
|---|---|
| PubChem CID | 160845239 |
| Molecular Formula | C22H24F3NO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 6-[6,8,8-trimethyl-2-oxo-4-(trifluoromethyl)pyrano[3,2-g]quinolin-9-yl]hexanoic acid |
| SMILES | CC1=CC(C)(C)N(CCCCCC(=O)O)c2cc3oc(=O)cc(C(F)(F)F)c3cc21 |
| InChI | InChI=1S/C22H24F3NO4/c1-13-12-21(2,3)26(8-6-4-5-7-19(27)28)17-11-18-15(9-14(13)17)16(22(23,24)25)10-20(29)30-18/h9-12H,4-8H2,1-3H3,(H,27,28) |
| InChIKey | CVIKMVNPTLHQJK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|