C28H32N2O4 — CID 135179386
tert-butyl 4-(6,8,8-trimethyl-2-oxo-3-pyridin-4-ylpyrano[3,2-g]quinolin-9-yl)butanoate (PubChem CID 135179386) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is tert-butyl 4-(6,8,8-trimethyl-2-oxo-3-pyridin-4-ylpyrano[3,2-g]quinolin-9-yl)butanoate.
| Compound Name | tert-butyl 4-(6,8,8-trimethyl-2-oxo-3-pyridin-4-ylpyrano[3,2-g]quinolin-9-yl)butanoate |
|---|---|
| PubChem CID | 135179386 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | tert-butyl 4-(6,8,8-trimethyl-2-oxo-3-pyridin-4-ylpyrano[3,2-g]quinolin-9-yl)butanoate |
| SMILES | CC1=CC(C)(C)N(CCCC(=O)OC(C)(C)C)c2cc3oc(=O)c(-c4ccncc4)cc3cc21 |
| InChI | InChI=1S/C28H32N2O4/c1-18-17-28(5,6)30(13-7-8-25(31)34-27(2,3)4)23-16-24-20(14-21(18)23)15-22(26(32)33-24)19-9-11-29-12-10-19/h9-12,14-17H,7-8,13H2,1-6H3 |
| InChIKey | AMCWJOFRFMOWNB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|