C19H23NO2S — CID 88892238
4,8,8-trimethyl-9-propyl-6-(sulfanylmethyl)pyrano[3,2-g]quinolin-2-one (PubChem CID 88892238) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 4,8,8-trimethyl-9-propyl-6-(sulfanylmethyl)pyrano[3,2-g]quinolin-2-one.
| Compound Name | 4,8,8-trimethyl-9-propyl-6-(sulfanylmethyl)pyrano[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 88892238 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4,8,8-trimethyl-9-propyl-6-(sulfanylmethyl)pyrano[3,2-g]quinolin-2-one |
| SMILES | CCCN1c2cc3oc(=O)cc(C)c3cc2C(CS)=CC1(C)C |
| InChI | InChI=1S/C19H23NO2S/c1-5-6-20-16-9-17-14(12(2)7-18(21)22-17)8-15(16)13(11-23)10-19(20,3)4/h7-10,23H,5-6,11H2,1-4H3 |
| InChIKey | XTZKMUGTBOLSBO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 33.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|