C18H23NO5S — CID 58689962
9-ethyl-4,8,8-trimethyl-6-(trioxidanylsulfanylmethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one (PubChem CID 58689962) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is 9-ethyl-4,8,8-trimethyl-6-(trioxidanylsulfanylmethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one.
| Compound Name | 9-ethyl-4,8,8-trimethyl-6-(trioxidanylsulfanylmethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 58689962 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 9-ethyl-4,8,8-trimethyl-6-(trioxidanylsulfanylmethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one |
| SMILES | CCN1c2cc3oc(=O)cc(C)c3cc2C(CSOOO)CC1(C)C |
| InChI | InChI=1S/C18H23NO5S/c1-5-19-15-8-16-13(11(2)6-17(20)22-16)7-14(15)12(9-18(19,3)4)10-25-24-23-21/h6-8,12,21H,5,9-10H2,1-4H3 |
| InChIKey | HKXQHXONNAJKPS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|