C15H17O6P — CID 139083763
7-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-4-methylchromen-2-one (PubChem CID 139083763) has the molecular formula C15H17O6P and a molecular weight of 324.27 g/mol. Its IUPAC name is 7-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-4-methylchromen-2-one.
| Compound Name | 7-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 139083763 |
| Molecular Formula | C15H17O6P |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 7-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OP3(=O)OCC(C)(C)CO3)ccc12 |
| InChI | InChI=1S/C15H17O6P/c1-10-6-14(16)20-13-7-11(4-5-12(10)13)21-22(17)18-8-15(2,3)9-19-22/h4-7H,8-9H2,1-3H3 |
| InChIKey | JNTFJKIIDGPUCV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|