C23H26F3NO6S — CID 168800389
[8,8-dimethyl-2-oxo-9-(6-oxoheptyl)-4-(trifluoromethyl)pyrano[3,2-g]quinolin-6-yl]methanesulfonic acid (PubChem CID 168800389) has the molecular formula C23H26F3NO6S and a molecular weight of 501.52 g/mol. Its IUPAC name is [8,8-dimethyl-2-oxo-9-(6-oxoheptyl)-4-(trifluoromethyl)pyrano[3,2-g]quinolin-6-yl]methanesulfonic acid.
| Compound Name | [8,8-dimethyl-2-oxo-9-(6-oxoheptyl)-4-(trifluoromethyl)pyrano[3,2-g]quinolin-6-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 168800389 |
| Molecular Formula | C23H26F3NO6S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | [8,8-dimethyl-2-oxo-9-(6-oxoheptyl)-4-(trifluoromethyl)pyrano[3,2-g]quinolin-6-yl]methanesulfonic acid |
| SMILES | CC(=O)CCCCCN1c2cc3oc(=O)cc(C(F)(F)F)c3cc2C(CS(=O)(=O)O)=CC1(C)C |
| InChI | InChI=1S/C23H26F3NO6S/c1-14(28)7-5-4-6-8-27-19-11-20-17(18(23(24,25)26)10-21(29)33-20)9-16(19)15(12-22(27,2)3)13-34(30,31)32/h9-12H,4-8,13H2,1-3H3,(H,30,31,32) |
| InChIKey | WKROFMLCQWMBAO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|