C14H13F3O6 — CID 101038427
6,7-bis(2-hydroxyethoxy)-4-(trifluoromethyl)chromen-2-one (PubChem CID 101038427) has the molecular formula C14H13F3O6 and a molecular weight of 334.25 g/mol. Its IUPAC name is 6,7-bis(2-hydroxyethoxy)-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 6,7-bis(2-hydroxyethoxy)-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 101038427 |
| Molecular Formula | C14H13F3O6 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 6,7-bis(2-hydroxyethoxy)-4-(trifluoromethyl)chromen-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2cc(OCCO)c(OCCO)cc2o1 |
| InChI | InChI=1S/C14H13F3O6/c15-14(16,17)9-6-13(20)23-10-7-12(22-4-2-19)11(5-8(9)10)21-3-1-18/h5-7,18-19H,1-4H2 |
| InChIKey | FDMPQKFZAOZRFZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|