C30H40N2O6S — CID 156871572
6-[[2,2,4,7,7-pentamethyl-1-(3-sulfopropyl)-8H-chromeno[3,2-g]quinolin-9-ylidene]amino]hexanoic acid (PubChem CID 156871572) has the molecular formula C30H40N2O6S and a molecular weight of 556.73 g/mol. Its IUPAC name is 6-[[2,2,4,7,7-pentamethyl-1-(3-sulfopropyl)-8H-chromeno[3,2-g]quinolin-9-ylidene]amino]hexanoic acid.
| Compound Name | 6-[[2,2,4,7,7-pentamethyl-1-(3-sulfopropyl)-8H-chromeno[3,2-g]quinolin-9-ylidene]amino]hexanoic acid |
|---|---|
| PubChem CID | 156871572 |
| Molecular Formula | C30H40N2O6S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 6-[[2,2,4,7,7-pentamethyl-1-(3-sulfopropyl)-8H-chromeno[3,2-g]quinolin-9-ylidene]amino]hexanoic acid |
| SMILES | CC1=CC(C)(C)N(CCCS(=O)(=O)O)c2cc3c(cc21)C=C1C(=C/C(=N/CCCCCC(=O)O)CC1(C)C)O3 |
| InChI | InChI=1S/C30H40N2O6S/c1-20-18-30(4,5)32(12-9-13-39(35,36)37)25-17-26-21(14-23(20)25)15-24-27(38-26)16-22(19-29(24,2)3)31-11-8-6-7-10-28(33)34/h14-18H,6-13,19H2,1-5H3,(H,33,34)(H,35,36,37)/b31-22- |
| InChIKey | YDSVYACQRWBHFW-VAMRJTSQSA-N |
| XLogP | 6.14 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|