C29H35ClN2O3 — CID 168860902
6-[[(6E)-8,8-dimethyl-6-(pyridin-1-ium-2-ylmethylidene)-7H-xanthen-3-yl]-ethylamino]hexanoic acid chloride (PubChem CID 168860902) has the molecular formula C29H35ClN2O3 and a molecular weight of 495.06 g/mol. Its IUPAC name is 6-[[(6E)-8,8-dimethyl-6-(pyridin-1-ium-2-ylmethylidene)-7H-xanthen-3-yl]-ethylamino]hexanoic acid chloride.
| Compound Name | 6-[[(6E)-8,8-dimethyl-6-(pyridin-1-ium-2-ylmethylidene)-7H-xanthen-3-yl]-ethylamino]hexanoic acid chloride |
|---|---|
| PubChem CID | 168860902 |
| Molecular Formula | C29H35ClN2O3 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 6-[[(6E)-8,8-dimethyl-6-(pyridin-1-ium-2-ylmethylidene)-7H-xanthen-3-yl]-ethylamino]hexanoic acid chloride |
| SMILES | CCN(CCCCCC(=O)O)c1ccc2c(c1)OC1=C/C(=C/c3cccc[nH+]3)CC(C)(C)C1=C2.[Cl-] |
| InChI | InChI=1S/C29H34N2O3.ClH/c1-4-31(15-9-5-6-11-28(32)33)24-13-12-22-18-25-27(34-26(22)19-24)17-21(20-29(25,2)3)16-23-10-7-8-14-30-23;/h7-8,10,12-14,16-19H,4-6,9,11,15,20H2,1-3H3,(H,32,33);1H/b21-16-; |
| InChIKey | ZNLORWMMXLAMOW-PLMZOXRSSA-N |
| XLogP | 3.15 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|