C34H41N2O8S+ — CID 173054466
[2-tert-butyl-4-[2-[7-[5-carboxypentyl(ethyl)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-ethyl-sulfoazanium (PubChem CID 173054466) has the molecular formula C34H41N2O8S+ and a molecular weight of 637.78 g/mol. Its IUPAC name is [2-tert-butyl-4-[2-[7-[5-carboxypentyl(ethyl)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-ethyl-sulfoazanium.
| Compound Name | [2-tert-butyl-4-[2-[7-[5-carboxypentyl(ethyl)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-ethyl-sulfoazanium |
|---|---|
| PubChem CID | 173054466 |
| Molecular Formula | C34H41N2O8S+ |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | [2-tert-butyl-4-[2-[7-[5-carboxypentyl(ethyl)amino]-2-oxochromen-3-yl]ethenyl]chromen-7-ylidene]-ethyl-sulfoazanium |
| SMILES | CCN(CCCCCC(=O)O)c1ccc2cc(C=Cc3cc(C(C)(C)C)oc4cc(=[N+](CC)S(=O)(=O)O)ccc3-4)c(=O)oc2c1 |
| InChI | InChI=1S/C34H40N2O8S/c1-6-35(18-10-8-9-11-32(37)38)26-15-14-24-19-25(33(39)44-29(24)21-26)13-12-23-20-31(34(3,4)5)43-30-22-27(16-17-28(23)30)36(7-2)45(40,41)42/h12-17,19-22H,6-11,18H2,1-5H3,(H-,37,38,40,41,42)/p+1 |
| InChIKey | LSXWOSNMZCYQTM-UHFFFAOYSA-O |
| XLogP | 6.02 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|