C21H25N3O9S3 — CID 130421637
5-[7-[ethyl-(6-hydrazinyl-6-oxohexyl)amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid (PubChem CID 130421637) has the molecular formula C21H25N3O9S3 and a molecular weight of 559.64 g/mol. Its IUPAC name is 5-[7-[ethyl-(6-hydrazinyl-6-oxohexyl)amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid.
| Compound Name | 5-[7-[ethyl-(6-hydrazinyl-6-oxohexyl)amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid |
|---|---|
| PubChem CID | 130421637 |
| Molecular Formula | C21H25N3O9S3 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 5-[7-[ethyl-(6-hydrazinyl-6-oxohexyl)amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid |
| SMILES | CCN(CCCCCC(=O)NN)c1ccc2cc(-c3sc(S(=O)(=O)O)cc3S(=O)(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C21H25N3O9S3/c1-2-24(9-5-3-4-6-18(25)23-22)14-8-7-13-10-15(21(26)33-16(13)11-14)20-17(35(27,28)29)12-19(34-20)36(30,31)32/h7-8,10-12H,2-6,9,22H2,1H3,(H,23,25)(H,27,28,29)(H,30,31,32) |
| InChIKey | OZXOWJVAOIYEIJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 197.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|