C28H32N2O11S2 — CID 130433612
5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2-sulfonic acid (PubChem CID 130433612) has the molecular formula C28H32N2O11S2 and a molecular weight of 636.70 g/mol. Its IUPAC name is 5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2-sulfonic acid.
| Compound Name | 5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 130433612 |
| Molecular Formula | C28H32N2O11S2 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | 5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2-sulfonic acid |
| SMILES | COCCOCCN(CCCCCC(=O)ON1C(=O)CCC1=O)c1ccc2cc(-c3ccc(S(=O)(=O)O)s3)c(=O)oc2c1 |
| InChI | InChI=1S/C28H32N2O11S2/c1-38-15-16-39-14-13-29(12-4-2-3-5-26(33)41-30-24(31)9-10-25(30)32)20-7-6-19-17-21(28(34)40-22(19)18-20)23-8-11-27(42-23)43(35,36)37/h6-8,11,17-18H,2-5,9-10,12-16H2,1H3,(H,35,36,37) |
| InChIKey | TZNOZNUBWQKTCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 169.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|