C28H32N2O14S3 — CID 130421610
5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid (PubChem CID 130421610) has the molecular formula C28H32N2O14S3 and a molecular weight of 716.76 g/mol. Its IUPAC name is 5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid.
| Compound Name | 5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid |
|---|---|
| PubChem CID | 130421610 |
| Molecular Formula | C28H32N2O14S3 |
| Molecular Weight | 716.76 g/mol |
| Exact Mass | 716.10 |
| IUPAC Name | 5-[7-[[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-[2-(2-methoxyethoxy)ethyl]amino]-2-oxochromen-3-yl]thiophene-2,4-disulfonic acid |
| SMILES | COCCOCCN(CCCCCC(=O)ON1C(=O)CCC1=O)c1ccc2cc(-c3sc(S(=O)(=O)O)cc3S(=O)(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C28H32N2O14S3/c1-41-13-14-42-12-11-29(10-4-2-3-5-25(33)44-30-23(31)8-9-24(30)32)19-7-6-18-15-20(28(34)43-21(18)16-19)27-22(46(35,36)37)17-26(45-27)47(38,39)40/h6-7,15-17H,2-5,8-14H2,1H3,(H,35,36,37)(H,38,39,40) |
| InChIKey | GVKXUFGBZXPMQO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 224.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|