C24H22ClNO10S2 — CID 59524756
5-(6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid (PubChem CID 59524756) has the molecular formula C24H22ClNO10S2 and a molecular weight of 584.02 g/mol. Its IUPAC name is 5-(6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid.
| Compound Name | 5-(6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid |
|---|---|
| PubChem CID | 59524756 |
| Molecular Formula | C24H22ClNO10S2 |
| Molecular Weight | 584.02 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | 5-(6-chloro-7-hydroxy-4-methyl-2-oxochromen-3-yl)-2-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]thiophene-3-sulfonic acid |
| SMILES | Cc1c(-c2cc(S(=O)(=O)O)c(CCCCCC(=O)ON3C(=O)CCC3=O)s2)c(=O)oc2cc(O)c(Cl)cc12 |
| InChI | InChI=1S/C24H22ClNO10S2/c1-12-13-9-14(25)15(27)10-16(13)35-24(31)23(12)18-11-19(38(32,33)34)17(37-18)5-3-2-4-6-22(30)36-26-20(28)7-8-21(26)29/h9-11,27H,2-8H2,1H3,(H,32,33,34) |
| InChIKey | CQRQQOIKILWRNN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.02 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|