C19H12ClNO10S2 — CID 59524785
5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]thiophene-3-sulfonic acid (PubChem CID 59524785) has the molecular formula C19H12ClNO10S2 and a molecular weight of 513.89 g/mol. Its IUPAC name is 5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]thiophene-3-sulfonic acid.
| Compound Name | 5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]thiophene-3-sulfonic acid |
|---|---|
| PubChem CID | 59524785 |
| Molecular Formula | C19H12ClNO10S2 |
| Molecular Weight | 513.89 g/mol |
| Exact Mass | 512.96 |
| IUPAC Name | 5-(6-chloro-7-hydroxy-2-oxochromen-3-yl)-2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]thiophene-3-sulfonic acid |
| SMILES | O=C(Cc1sc(-c2cc3cc(Cl)c(O)cc3oc2=O)cc1S(=O)(=O)O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H12ClNO10S2/c20-10-4-8-3-9(19(26)30-12(8)5-11(10)22)13-6-15(33(27,28)29)14(32-13)7-18(25)31-21-16(23)1-2-17(21)24/h3-6,22H,1-2,7H2,(H,27,28,29) |
| InChIKey | FGNGKSJHARSTSM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.89 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|