C20H13NO8S — CID 88872215
(2,5-dioxopyrrolidin-1-yl) 7-acetyloxy-2-oxo-3-thiophen-2-ylchromene-6-carboxylate (PubChem CID 88872215) has the molecular formula C20H13NO8S and a molecular weight of 427.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 7-acetyloxy-2-oxo-3-thiophen-2-ylchromene-6-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 7-acetyloxy-2-oxo-3-thiophen-2-ylchromene-6-carboxylate |
|---|---|
| PubChem CID | 88872215 |
| Molecular Formula | C20H13NO8S |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 7-acetyloxy-2-oxo-3-thiophen-2-ylchromene-6-carboxylate |
| SMILES | CC(=O)Oc1cc2oc(=O)c(-c3cccs3)cc2cc1C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H13NO8S/c1-10(22)27-15-9-14-11(8-13(19(25)28-14)16-3-2-6-30-16)7-12(15)20(26)29-21-17(23)4-5-18(21)24/h2-3,6-9H,4-5H2,1H3 |
| InChIKey | XCRDDWNFORNLBD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|