C21H14ClNO8S — CID 56592054
(2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)thiophen-2-yl]acetate (PubChem CID 56592054) has the molecular formula C21H14ClNO8S and a molecular weight of 475.86 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)thiophen-2-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 56592054 |
| Molecular Formula | C21H14ClNO8S |
| Molecular Weight | 475.86 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)thiophen-2-yl]acetate |
| SMILES | CC(=O)Oc1cc2oc(=O)c(-c3ccc(CC(=O)ON4C(=O)CCC4=O)s3)cc2cc1Cl |
| InChI | InChI=1S/C21H14ClNO8S/c1-10(24)29-16-9-15-11(7-14(16)22)6-13(21(28)30-15)17-3-2-12(32-17)8-20(27)31-23-18(25)4-5-19(23)26/h2-3,6-7,9H,4-5,8H2,1H3 |
| InChIKey | AQLSYQOGGLYNHY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|