C23H13ClN2O8S — CID 123599797
(2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)-1,3-benzothiazole-6-carboxylate (PubChem CID 123599797) has the molecular formula C23H13ClN2O8S and a molecular weight of 512.88 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 123599797 |
| Molecular Formula | C23H13ClN2O8S |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-chloro-2-oxochromen-3-yl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CC(=O)Oc1cc2oc(=O)c(-c3nc4ccc(C(=O)On5c(O)ccc5O)cc4s3)cc2cc1Cl |
| InChI | InChI=1S/C23H13ClN2O8S/c1-10(27)32-17-9-16-12(7-14(17)24)6-13(23(31)33-16)21-25-15-3-2-11(8-18(15)35-21)22(30)34-26-19(28)4-5-20(26)29/h2-9,28-29H,1H3 |
| InChIKey | IPYFNQLDVBINNU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|