C23H14FN3O8 — CID 123273283
(2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-fluoro-2-oxochromen-3-yl)-3H-benzimidazole-5-carboxylate (PubChem CID 123273283) has the molecular formula C23H14FN3O8 and a molecular weight of 479.38 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-fluoro-2-oxochromen-3-yl)-3H-benzimidazole-5-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-fluoro-2-oxochromen-3-yl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 123273283 |
| Molecular Formula | C23H14FN3O8 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(7-acetyloxy-6-fluoro-2-oxochromen-3-yl)-3H-benzimidazole-5-carboxylate |
| SMILES | CC(=O)Oc1cc2oc(=O)c(-c3nc4ccc(C(=O)On5c(O)ccc5O)cc4[nH]3)cc2cc1F |
| InChI | InChI=1S/C23H14FN3O8/c1-10(28)33-18-9-17-12(7-14(18)24)6-13(23(32)34-17)21-25-15-3-2-11(8-16(15)26-21)22(31)35-27-19(29)4-5-20(27)30/h2-9,29-30H,1H3,(H,25,26) |
| InChIKey | VSGMZQQSSPKJMK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|