C22H15ClFNO9 — CID 58571992
(2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-8-fluoro-4-methyl-2-oxochromen-3-yl)furan-2-yl]acetate (PubChem CID 58571992) has the molecular formula C22H15ClFNO9 and a molecular weight of 491.81 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-8-fluoro-4-methyl-2-oxochromen-3-yl)furan-2-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-8-fluoro-4-methyl-2-oxochromen-3-yl)furan-2-yl]acetate |
|---|---|
| PubChem CID | 58571992 |
| Molecular Formula | C22H15ClFNO9 |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(7-acetyloxy-6-chloro-8-fluoro-4-methyl-2-oxochromen-3-yl)furan-2-yl]acetate |
| SMILES | CC(=O)Oc1c(Cl)cc2c(C)c(-c3ccc(CC(=O)ON4C(=O)CCC4=O)o3)c(=O)oc2c1F |
| InChI | InChI=1S/C22H15ClFNO9/c1-9-12-8-13(23)21(31-10(2)26)19(24)20(12)33-22(30)18(9)14-4-3-11(32-14)7-17(29)34-25-15(27)5-6-16(25)28/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | ZPZIDICTLGZDPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 133.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|