C25H21ClFNO8S — CID 56591593
(2,5-dioxopyrrolidin-1-yl) 6-[5-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)thiophen-2-yl]hexanoate (PubChem CID 56591593) has the molecular formula C25H21ClFNO8S and a molecular weight of 549.96 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[5-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)thiophen-2-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)thiophen-2-yl]hexanoate |
|---|---|
| PubChem CID | 56591593 |
| Molecular Formula | C25H21ClFNO8S |
| Molecular Weight | 549.96 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)thiophen-2-yl]hexanoate |
| SMILES | CC(=O)Oc1c(Cl)cc2cc(-c3ccc(CCCCCC(=O)ON4C(=O)CCC4=O)s3)c(=O)oc2c1F |
| InChI | InChI=1S/C25H21ClFNO8S/c1-13(29)34-24-17(26)12-14-11-16(25(33)35-23(14)22(24)27)18-8-7-15(37-18)5-3-2-4-6-21(32)36-28-19(30)9-10-20(28)31/h7-8,11-12H,2-6,9-10H2,1H3 |
| InChIKey | CKMWGTNNDAVJQS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|