C20H12ClFN2O8S — CID 58571975
(2,5-dioxopyrrolidin-1-yl) 2-[2-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetate (PubChem CID 58571975) has the molecular formula C20H12ClFN2O8S and a molecular weight of 494.84 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 58571975 |
| Molecular Formula | C20H12ClFN2O8S |
| Molecular Weight | 494.84 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(7-acetyloxy-6-chloro-8-fluoro-2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetate |
| SMILES | CC(=O)Oc1c(Cl)cc2cc(-c3ncc(CC(=O)ON4C(=O)CCC4=O)s3)c(=O)oc2c1F |
| InChI | InChI=1S/C20H12ClFN2O8S/c1-8(25)30-18-12(21)5-9-4-11(20(29)31-17(9)16(18)22)19-23-7-10(33-19)6-15(28)32-24-13(26)2-3-14(24)27/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | DLZHEMGOLTXEAO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 133.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|