C22H15Cl2NO7S — CID 56591691
(2,5-dioxopyrrolidin-1-yl) 2-[5-(6-acetyloxy-5,7-dichloro-3-oxo-4H-naphthalen-2-yl)thiophen-2-yl]acetate (PubChem CID 56591691) has the molecular formula C22H15Cl2NO7S and a molecular weight of 508.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[5-(6-acetyloxy-5,7-dichloro-3-oxo-4H-naphthalen-2-yl)thiophen-2-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(6-acetyloxy-5,7-dichloro-3-oxo-4H-naphthalen-2-yl)thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 56591691 |
| Molecular Formula | C22H15Cl2NO7S |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[5-(6-acetyloxy-5,7-dichloro-3-oxo-4H-naphthalen-2-yl)thiophen-2-yl]acetate |
| SMILES | CC(=O)Oc1c(Cl)cc2c(c1Cl)CC(=O)C(c1ccc(CC(=O)ON3C(=O)CCC3=O)s1)=C2 |
| InChI | InChI=1S/C22H15Cl2NO7S/c1-10(26)31-22-15(23)7-11-6-14(16(27)9-13(11)21(22)24)17-3-2-12(33-17)8-20(30)32-25-18(28)4-5-19(25)29/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | BLJLVSDBFSZFKQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|