C16H19ClN2O12 — CID 161222115
(2-chloro-2-oxoethyl) acetate;(2,5-dioxopyrrolidin-1-yl) 2-acetyloxyacetate;1-hydroxypyrrolidine-2,5-dione (PubChem CID 161222115) has the molecular formula C16H19ClN2O12 and a molecular weight of 466.78 g/mol. Its IUPAC name is (2-chloro-2-oxoethyl) acetate;(2,5-dioxopyrrolidin-1-yl) 2-acetyloxyacetate;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | (2-chloro-2-oxoethyl) acetate;(2,5-dioxopyrrolidin-1-yl) 2-acetyloxyacetate;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 161222115 |
| Molecular Formula | C16H19ClN2O12 |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | (2-chloro-2-oxoethyl) acetate;(2,5-dioxopyrrolidin-1-yl) 2-acetyloxyacetate;1-hydroxypyrrolidine-2,5-dione |
| SMILES | CC(=O)OCC(=O)Cl.CC(=O)OCC(=O)ON1C(=O)CCC1=O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H9NO6.C4H5ClO3.C4H5NO3/c1-5(10)14-4-8(13)15-9-6(11)2-3-7(9)12;1-3(6)8-2-4(5)7;6-3-1-2-4(7)5(3)8/h2-4H2,1H3;2H2,1H3;8H,1-2H2 |
| InChIKey | UXQOIHVEVDPONL-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 190.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|