C27H26ClNO9S — CID 58571995
(2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6-chloro-4-methyl-2-oxochromen-3-yl]thiophen-2-yl]hexanoate (PubChem CID 58571995) has the molecular formula C27H26ClNO9S and a molecular weight of 576.02 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6-chloro-4-methyl-2-oxochromen-3-yl]thiophen-2-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6-chloro-4-methyl-2-oxochromen-3-yl]thiophen-2-yl]hexanoate |
|---|---|
| PubChem CID | 58571995 |
| Molecular Formula | C27H26ClNO9S |
| Molecular Weight | 576.02 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-6-chloro-4-methyl-2-oxochromen-3-yl]thiophen-2-yl]hexanoate |
| SMILES | CC(=O)OCOc1cc2oc(=O)c(-c3ccc(CCCCCC(=O)ON4C(=O)CCC4=O)s3)c(C)c2cc1Cl |
| InChI | InChI=1S/C27H26ClNO9S/c1-15-18-12-19(28)21(36-14-35-16(2)30)13-20(18)37-27(34)26(15)22-9-8-17(39-22)6-4-3-5-7-25(33)38-29-23(31)10-11-24(29)32/h8-9,12-13H,3-7,10-11,14H2,1-2H3 |
| InChIKey | FDOVFTMVPRKJNX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.02 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|